C24H26F2O — CID 143103458
(1E)-1-(3,4-difluorophenyl)-3-methyl-2-(2-methyl-5-prop-1-en-2-ylphenyl)buta-1,3-dien-1-ol;prop-1-ene (PubChem CID 143103458) has the molecular formula C24H26F2O and a molecular weight of 368.47 g/mol. Its IUPAC name is (1E)-1-(3,4-difluorophenyl)-3-methyl-2-(2-methyl-5-prop-1-en-2-ylphenyl)buta-1,3-dien-1-ol;prop-1-ene.
| Compound Name | (1E)-1-(3,4-difluorophenyl)-3-methyl-2-(2-methyl-5-prop-1-en-2-ylphenyl)buta-1,3-dien-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 143103458 |
| Molecular Formula | C24H26F2O |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1E)-1-(3,4-difluorophenyl)-3-methyl-2-(2-methyl-5-prop-1-en-2-ylphenyl)buta-1,3-dien-1-ol;prop-1-ene |
| SMILES | C=C(C)/C(=C(\O)c1ccc(F)c(F)c1)c1cc(C(=C)C)ccc1C.C=CC |
| InChI | InChI=1S/C21H20F2O.C3H6/c1-12(2)15-7-6-14(5)17(10-15)20(13(3)4)21(24)16-8-9-18(22)19(23)11-16;1-3-2/h6-11,24H,1,3H2,2,4-5H3;3H,1H2,2H3/b21-20+; |
| InChIKey | QRVUCYZIPYFXNE-ANVLNOONSA-N |
| XLogP | 7.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|