C9H16O2S — CID 14310370
(3aR,6aS)-5,5-dimethoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]thiophene (PubChem CID 14310370) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is (3aR,6aS)-5,5-dimethoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]thiophene.
| Compound Name | (3aR,6aS)-5,5-dimethoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]thiophene |
|---|---|
| PubChem CID | 14310370 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (3aR,6aS)-5,5-dimethoxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]thiophene |
| SMILES | COC1(OC)C[C@H]2CSC[C@H]2C1 |
| InChI | InChI=1S/C9H16O2S/c1-10-9(11-2)3-7-5-12-6-8(7)4-9/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | ZOXZJIUORLAQRZ-OCAPTIKFSA-N |
| XLogP | 1.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|