About methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate
methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate (PubChem CID 143103800) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate |
| PubChem CID | 143103800 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate |
| SMILES | COC(=O)C1=CCC=C(CN)C=C1 |
| InChI | InChI=1S/C10H13NO2/c1-13-10(12)9-4-2-3-8(7-11)5-6-9/h3-6H,2,7,11H2,1H3 |
| InChIKey | MOQVPTGGKOFFMP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
The IUPAC name of methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate (CID 143103800) is methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate.
What is the SMILES notation for methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
The canonical SMILES for methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate is COC(=O)C1=CCC=C(CN)C=C1.
What is the InChIKey of methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
The InChIKey is MOQVPTGGKOFFMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-13-10(12)9-4-2-3-8(7-11)5-6-9/h3-6H,2,7,11H2,1H3.
What are the key properties of methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate has a molecular weight of 179.22 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(aminomethyl)cyclohepta-1,4,6-triene-1-carboxylate is sourced from PubChem (CID 143103800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).