C14H25N3OS — CID 143104445
1-N,2-N,3-trimethyl-1-N-(N-methylanilino)sulfanyloxybutane-1,2-diamine (PubChem CID 143104445) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 1-N,2-N,3-trimethyl-1-N-(N-methylanilino)sulfanyloxybutane-1,2-diamine.
| Compound Name | 1-N,2-N,3-trimethyl-1-N-(N-methylanilino)sulfanyloxybutane-1,2-diamine |
|---|---|
| PubChem CID | 143104445 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-N,2-N,3-trimethyl-1-N-(N-methylanilino)sulfanyloxybutane-1,2-diamine |
| SMILES | CNC(CN(C)OSN(C)c1ccccc1)C(C)C |
| InChI | InChI=1S/C14H25N3OS/c1-12(2)14(15-3)11-16(4)18-19-17(5)13-9-7-6-8-10-13/h6-10,12,14-15H,11H2,1-5H3 |
| InChIKey | GPJUWLUVRMLXJN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|