C34H60N4O — CID 143105132
(5R)-N-(cyclopropylmethyl)-5-[1-[[2-[(1R,5S)-6,6-dimethyl-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenylamino]-7,7-dimethylnonanamide (PubChem CID 143105132) has the molecular formula C34H60N4O and a molecular weight of 540.88 g/mol. Its IUPAC name is (5R)-N-(cyclopropylmethyl)-5-[1-[[2-[(1R,5S)-6,6-dimethyl-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenylamino]-7,7-dimethylnonanamide.
| Compound Name | (5R)-N-(cyclopropylmethyl)-5-[1-[[2-[(1R,5S)-6,6-dimethyl-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenylamino]-7,7-dimethylnonanamide |
|---|---|
| PubChem CID | 143105132 |
| Molecular Formula | C34H60N4O |
| Molecular Weight | 540.88 g/mol |
| Exact Mass | 540.48 |
| IUPAC Name | (5R)-N-(cyclopropylmethyl)-5-[1-[[2-[(1R,5S)-6,6-dimethyl-2-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexan-3-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenylamino]-7,7-dimethylnonanamide |
| SMILES | C=C(NC(C(=C)N1C[C@H]2[C@@H](C1C(=C)C)C2(C)C)C(C)(C)C)N[C@H](CCCC(=O)NCC1CC1)CC(C)(C)CC |
| InChI | InChI=1S/C34H60N4O/c1-13-33(9,10)19-26(15-14-16-28(39)35-20-25-17-18-25)36-24(5)37-31(32(6,7)8)23(4)38-21-27-29(34(27,11)12)30(38)22(2)3/h25-27,29-31,36-37H,2,4-5,13-21H2,1,3,6-12H3,(H,35,39)/t26-,27+,29+,30?,31?/m1/s1 |
| InChIKey | PPONJMYBXRAHKQ-MIHVQCLNSA-N |
| XLogP | 6.99 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.88 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|