C34H60N2 — CID 143105200
1-N-(8-cyclopropyl-2,2-dimethyl-6-methylideneoctan-3-yl)-1-N'-[6-[(1S,2R)-2-ethyl-3-methylcyclopropyl]-2,2,7-trimethyl-4-methylideneoct-7-en-3-yl]ethene-1,1-diamine (PubChem CID 143105200) has the molecular formula C34H60N2 and a molecular weight of 496.87 g/mol. Its IUPAC name is 1-N-(8-cyclopropyl-2,2-dimethyl-6-methylideneoctan-3-yl)-1-N'-[6-[(1S,2R)-2-ethyl-3-methylcyclopropyl]-2,2,7-trimethyl-4-methylideneoct-7-en-3-yl]ethene-1,1-diamine.
| Compound Name | 1-N-(8-cyclopropyl-2,2-dimethyl-6-methylideneoctan-3-yl)-1-N'-[6-[(1S,2R)-2-ethyl-3-methylcyclopropyl]-2,2,7-trimethyl-4-methylideneoct-7-en-3-yl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 143105200 |
| Molecular Formula | C34H60N2 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 496.48 |
| IUPAC Name | 1-N-(8-cyclopropyl-2,2-dimethyl-6-methylideneoctan-3-yl)-1-N'-[6-[(1S,2R)-2-ethyl-3-methylcyclopropyl]-2,2,7-trimethyl-4-methylideneoct-7-en-3-yl]ethene-1,1-diamine |
| SMILES | C=C(CCC1CC1)CCC(NC(=C)NC(C(=C)CC(C(=C)C)[C@H]1C(C)[C@H]1CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C34H60N2/c1-14-28-25(6)31(28)29(22(2)3)21-24(5)32(34(11,12)13)36-26(7)35-30(33(8,9)10)20-16-23(4)15-17-27-18-19-27/h25,27-32,35-36H,2,4-5,7,14-21H2,1,3,6,8-13H3/t25?,28-,29?,30?,31+,32?/m1/s1 |
| InChIKey | FHLVAZNCEAFPPI-MSWITDHUSA-N |
| XLogP | 9.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|