C13H23N3O2S — CID 143105273
N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylbenzenesulfonamide (PubChem CID 143105273) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 143105273 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(2S)-2-hydrazinyl-3,3-dimethylbutyl]-N-methylbenzenesulfonamide |
| SMILES | CN(C[C@@H](NN)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H23N3O2S/c1-13(2,3)12(15-14)10-16(4)19(17,18)11-8-6-5-7-9-11/h5-9,12,15H,10,14H2,1-4H3/t12-/m1/s1 |
| InChIKey | KPUILNJJVJPVAB-GFCCVEGCSA-N |
| XLogP | 1.19 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|