C22H35F2N5O5 — CID 143105335
(3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-1-(ethylamino)-5,5-difluoro-1,2-dioxopentan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 143105335) has the molecular formula C22H35F2N5O5 and a molecular weight of 487.55 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-1-(ethylamino)-5,5-difluoro-1,2-dioxopentan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-1-(ethylamino)-5,5-difluoro-1,2-dioxopentan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 143105335 |
| Molecular Formula | C22H35F2N5O5 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (3S,3aS,6aR)-2-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-1-(ethylamino)-5,5-difluoro-1,2-dioxopentan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CCNC(=O)C(=O)[C@H](CC(F)F)NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@@H](NC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C22H35F2N5O5/c1-5-26-19(32)16(30)13(9-14(23)24)27-18(31)15-12-8-6-7-11(12)10-29(15)20(33)17(22(2,3)4)28-21(25)34/h11-15,17H,5-10H2,1-4H3,(H,26,32)(H,27,31)(H3,25,28,34)/t11-,12-,13-,15-,17+/m0/s1 |
| InChIKey | QGWBFZIDLFNUJX-VERFIZQUSA-N |
| XLogP | 0.54 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|