C13H35N3OS2 — CID 143105348
ethane;1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine;sulfane (PubChem CID 143105348) has the molecular formula C13H35N3OS2 and a molecular weight of 313.58 g/mol. Its IUPAC name is ethane;1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine;sulfane.
| Compound Name | ethane;1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine;sulfane |
|---|---|
| PubChem CID | 143105348 |
| Molecular Formula | C13H35N3OS2 |
| Molecular Weight | 313.58 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | ethane;1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine;sulfane |
| SMILES | CC.CCN(C)SON(C)CC(NC)C(C)(C)C.S |
| InChI | InChI=1S/C11H27N3OS.C2H6.H2S/c1-8-14(7)16-15-13(6)9-10(12-5)11(2,3)4;1-2;/h10,12H,8-9H2,1-7H3;1-2H3;1H2 |
| InChIKey | XNAYKADWGAWWQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|