C11H27N3OS — CID 143105349
1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine (PubChem CID 143105349) has the molecular formula C11H27N3OS and a molecular weight of 249.42 g/mol. Its IUPAC name is 1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine.
| Compound Name | 1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 143105349 |
| Molecular Formula | C11H27N3OS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 1-N-[ethyl(methyl)amino]sulfanyloxy-1-N,2-N,3,3-tetramethylbutane-1,2-diamine |
| SMILES | CCN(C)SON(C)CC(NC)C(C)(C)C |
| InChI | InChI=1S/C11H27N3OS/c1-8-14(7)16-15-13(6)9-10(12-5)11(2,3)4/h10,12H,8-9H2,1-7H3 |
| InChIKey | GTFBZADMPZYVQH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|