C15H37N3OS2 — CID 143105361
1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine;ethane;sulfane (PubChem CID 143105361) has the molecular formula C15H37N3OS2 and a molecular weight of 339.62 g/mol. Its IUPAC name is 1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine;ethane;sulfane.
| Compound Name | 1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine;ethane;sulfane |
|---|---|
| PubChem CID | 143105361 |
| Molecular Formula | C15H37N3OS2 |
| Molecular Weight | 339.62 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine;ethane;sulfane |
| SMILES | CC.CNC(CN(CC1CC1)OSN(C)C)C(C)(C)C.S |
| InChI | InChI=1S/C13H29N3OS.C2H6.H2S/c1-13(2,3)12(14-4)10-16(9-11-7-8-11)17-18-15(5)6;1-2;/h11-12,14H,7-10H2,1-6H3;1-2H3;1H2 |
| InChIKey | GASNPEAUUUARKK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|