C13H29N3OS — CID 143105362
1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine (PubChem CID 143105362) has the molecular formula C13H29N3OS and a molecular weight of 275.46 g/mol. Its IUPAC name is 1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine.
| Compound Name | 1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 143105362 |
| Molecular Formula | C13H29N3OS |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-N-(cyclopropylmethyl)-1-N-(dimethylaminosulfanyloxy)-2-N,3,3-trimethylbutane-1,2-diamine |
| SMILES | CNC(CN(CC1CC1)OSN(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29N3OS/c1-13(2,3)12(14-4)10-16(9-11-7-8-11)17-18-15(5)6/h11-12,14H,7-10H2,1-6H3 |
| InChIKey | MZFGKYYIGMSKNI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|