About 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol
1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol (PubChem CID 143105374) has the molecular formula C12H27N3O
and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol.
Molecular Properties
| Compound Name | 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol |
| PubChem CID | 143105374 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol |
| SMILES | CN[C@H](CN1CCCN(C)C1O)C(C)(C)C |
| InChI | InChI=1S/C12H27N3O/c1-12(2,3)10(13-4)9-15-8-6-7-14(5)11(15)16/h10-11,13,16H,6-9H2,1-5H3/t10-,11?/m1/s1 |
| InChIKey | QJMQGTKVIWDAJE-NFJWQWPMSA-N |
| XLogP | 0.53 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol?
The IUPAC name of 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol (CID 143105374) is 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol.
What is the SMILES notation for 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol?
The canonical SMILES for 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol is CN[C@H](CN1CCCN(C)C1O)C(C)(C)C.
What is the InChIKey of 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol?
The InChIKey is QJMQGTKVIWDAJE-NFJWQWPMSA-N. The full InChI is InChI=1S/C12H27N3O/c1-12(2,3)10(13-4)9-15-8-6-7-14(5)11(15)16/h10-11,13,16H,6-9H2,1-5H3/t10-,11?/m1/s1.
What are the key properties of 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol?
1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol has a molecular weight of 229.37 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-3-methyl-1,3-diazinan-2-ol is sourced from PubChem (CID 143105374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).