C23H37F2N5O5 — CID 143105390
(2S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-4-propylpyrrolidine-2-carboxamide (PubChem CID 143105390) has the molecular formula C23H37F2N5O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-4-propylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-4-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143105390 |
| Molecular Formula | C23H37F2N5O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[(3S)-5,5-difluoro-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]-4-propylpyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)[C@H](CC(F)F)NC(=O)[C@@H]1C[C@@H](CCC)CN1C(=O)[C@@H](NC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C23H37F2N5O5/c1-6-8-13-10-15(30(12-13)21(34)18(23(3,4)5)29-22(26)35)19(32)28-14(11-16(24)25)17(31)20(33)27-9-7-2/h7,13-16,18H,2,6,8-12H2,1,3-5H3,(H,27,33)(H,28,32)(H3,26,29,35)/t13-,14+,15+,18-/m1/s1 |
| InChIKey | POKUBQGSKBRJJT-LDDOYCOJSA-N |
| XLogP | 1.10 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|