C28H35N5O5 — CID 143105419
1-[2-(2,3-dihydro-1H-inden-2-yl)-2-(methylcarbamoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide (PubChem CID 143105419) has the molecular formula C28H35N5O5 and a molecular weight of 521.62 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1H-inden-2-yl)-2-(methylcarbamoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(2,3-dihydro-1H-inden-2-yl)-2-(methylcarbamoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143105419 |
| Molecular Formula | C28H35N5O5 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 1-[2-(2,3-dihydro-1H-inden-2-yl)-2-(methylcarbamoylamino)acetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C#CCCC(NC(=O)C1CCCN1C(=O)C(NC(=O)NC)C1Cc2ccccc2C1)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C28H35N5O5/c1-4-6-12-21(24(34)26(36)30-14-5-2)31-25(35)22-13-9-15-33(22)27(37)23(32-28(38)29-3)20-16-18-10-7-8-11-19(18)17-20/h1,5,7-8,10-11,20-23H,2,6,9,12-17H2,3H3,(H,30,36)(H,31,35)(H2,29,32,38) |
| InChIKey | QWZXNYPWTPRNDA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|