About but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone
but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone (PubChem CID 143105460) has the molecular formula C17H39NO
and a molecular weight of 273.50 g/mol. Its IUPAC name is but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone.
Molecular Properties
| Compound Name | but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone |
| PubChem CID | 143105460 |
| Molecular Formula | C17H39NO |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 273.30 |
| IUPAC Name | but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone |
| SMILES | C=CCC.CC.CC.CC.CC(=O)C1CCCN1C |
| InChI | InChI=1S/C7H13NO.C4H8.3C2H6/c1-6(9)7-4-3-5-8(7)2;1-3-4-2;3*1-2/h7H,3-5H2,1-2H3;3H,1,4H2,2H3;3*1-2H3 |
| InChIKey | ZPWKVGHMQLZIQB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone?
The IUPAC name of but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone (CID 143105460) is but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone.
What is the SMILES notation for but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone?
The canonical SMILES for but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone is C=CCC.CC.CC.CC.CC(=O)C1CCCN1C.
What is the InChIKey of but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone?
The InChIKey is ZPWKVGHMQLZIQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C4H8.3C2H6/c1-6(9)7-4-3-5-8(7)2;1-3-4-2;3*1-2/h7H,3-5H2,1-2H3;3H,1,4H2,2H3;3*1-2H3.
What are the key properties of but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone?
but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone has a molecular weight of 273.50 g/mol, XLogP of 5.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;ethane;1-(1-methylpyrrolidin-2-yl)ethanone is sourced from PubChem (CID 143105460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).