C12H29N3OS — CID 143105513
1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine (PubChem CID 143105513) has the molecular formula C12H29N3OS and a molecular weight of 263.45 g/mol. Its IUPAC name is 1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine.
| Compound Name | 1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine |
|---|---|
| PubChem CID | 143105513 |
| Molecular Formula | C12H29N3OS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 1-N,2-N,3,3-tetramethyl-1-N-[methyl(propan-2-yl)amino]sulfanyloxybutane-1,2-diamine |
| SMILES | CNC(CN(C)OSN(C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H29N3OS/c1-10(2)15(8)17-16-14(7)9-11(13-6)12(3,4)5/h10-11,13H,9H2,1-8H3 |
| InChIKey | STZXWQAYOJSTBL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|