C32H54F3N5O6S — CID 143106006
N-(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)-1-[3,3-dimethyl-2-[[1-(1-oxothian-2-yl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;propane (PubChem CID 143106006) has the molecular formula C32H54F3N5O6S and a molecular weight of 693.87 g/mol. Its IUPAC name is N-(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)-1-[3,3-dimethyl-2-[[1-(1-oxothian-2-yl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;propane.
| Compound Name | N-(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)-1-[3,3-dimethyl-2-[[1-(1-oxothian-2-yl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;propane |
|---|---|
| PubChem CID | 143106006 |
| Molecular Formula | C32H54F3N5O6S |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.37 |
| IUPAC Name | N-(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)-1-[3,3-dimethyl-2-[[1-(1-oxothian-2-yl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;propane |
| SMILES | CC(C)(C)C(NC(=O)NC1(C2CCCCS2=O)CCCCC1)C(=O)N1CCCC1C(=O)NC(CCC(F)(F)F)C(=O)C(N)=O.CCC |
| InChI | InChI=1S/C29H46F3N5O6S.C3H8/c1-27(2,3)22(35-26(42)36-28(13-6-4-7-14-28)20-11-5-8-17-44(20)43)25(41)37-16-9-10-19(37)24(40)34-18(21(38)23(33)39)12-15-29(30,31)32;1-3-2/h18-20,22H,4-17H2,1-3H3,(H2,33,39)(H,34,40)(H2,35,36,42);3H2,1-2H3 |
| InChIKey | RDQAJEXGQREHDG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|