About ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine
ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine (PubChem CID 143106494) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine.
Molecular Properties
| Compound Name | ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine |
| PubChem CID | 143106494 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine |
| SMILES | CC.[H]/N=C/C(C=C)=C(\N)C=C |
| InChI | InChI=1S/C7H10N2.C2H6/c1-3-6(5-8)7(9)4-2;1-2/h3-5,8H,1-2,9H2;1-2H3/b7-6-,8-5+; |
| InChIKey | MTORMFIEKBYOIN-LAPANCLDSA-N |
| XLogP | 2.25 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
The IUPAC name of ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine (CID 143106494) is ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine.
What is the SMILES notation for ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
The canonical SMILES for ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine is CC.[H]/N=C/C(C=C)=C(\N)C=C.
What is the InChIKey of ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
The InChIKey is MTORMFIEKBYOIN-LAPANCLDSA-N. The full InChI is InChI=1S/C7H10N2.C2H6/c1-3-6(5-8)7(9)4-2;1-2/h3-5,8H,1-2,9H2;1-2H3/b7-6-,8-5+;.
What are the key properties of ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine has a molecular weight of 152.24 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine is sourced from PubChem (CID 143106494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).