C23H36N4O2 — CID 143106605
4-[5-[(4-carbamimidoylphenyl)methoxy]pentoxy]cyclohepta-2,4-diene-1-carboximidamide;ethane (PubChem CID 143106605) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 4-[5-[(4-carbamimidoylphenyl)methoxy]pentoxy]cyclohepta-2,4-diene-1-carboximidamide;ethane.
| Compound Name | 4-[5-[(4-carbamimidoylphenyl)methoxy]pentoxy]cyclohepta-2,4-diene-1-carboximidamide;ethane |
|---|---|
| PubChem CID | 143106605 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 4-[5-[(4-carbamimidoylphenyl)methoxy]pentoxy]cyclohepta-2,4-diene-1-carboximidamide;ethane |
| SMILES | CC.[H]/N=C(\N)c1ccc(COCCCCCOC2=CCCC(/C(N)=N/[H])C=C2)cc1 |
| InChI | InChI=1S/C21H30N4O2.C2H6/c22-20(23)17-5-4-6-19(12-11-17)27-14-3-1-2-13-26-15-16-7-9-18(10-8-16)21(24)25;1-2/h6-12,17H,1-5,13-15H2,(H3,22,23)(H3,24,25);1-2H3 |
| InChIKey | DKJMTGPZZDNIKL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|