C8H11FO — CID 143106657
2-ethoxy-5-fluorocyclohexa-1,3-diene (PubChem CID 143106657) has the molecular formula C8H11FO and a molecular weight of 142.17 g/mol. Its IUPAC name is 2-ethoxy-5-fluorocyclohexa-1,3-diene.
| Compound Name | 2-ethoxy-5-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143106657 |
| Molecular Formula | C8H11FO |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 2-ethoxy-5-fluorocyclohexa-1,3-diene |
| SMILES | CCOC1=CCC(F)C=C1 |
| InChI | InChI=1S/C8H11FO/c1-2-10-8-5-3-7(9)4-6-8/h3,5-7H,2,4H2,1H3 |
| InChIKey | VGOFOYRVCSWWLC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |