C9H16N2 — CID 143106734
3-methyl-N-propyl-2,3-dihydropyridin-4-amine (PubChem CID 143106734) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-methyl-N-propyl-2,3-dihydropyridin-4-amine.
| Compound Name | 3-methyl-N-propyl-2,3-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 143106734 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-methyl-N-propyl-2,3-dihydropyridin-4-amine |
| SMILES | CCCNC1=CC=NCC1C |
| InChI | InChI=1S/C9H16N2/c1-3-5-11-9-4-6-10-7-8(9)2/h4,6,8,11H,3,5,7H2,1-2H3 |
| InChIKey | IKKWHXSZJJGNIM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |