About ethane;1-ethoxy-4-fluorobenzene
ethane;1-ethoxy-4-fluorobenzene (PubChem CID 143106824) has the molecular formula C12H21FO
and a molecular weight of 200.30 g/mol. Its IUPAC name is ethane;1-ethoxy-4-fluorobenzene.
Molecular Properties
| Compound Name | ethane;1-ethoxy-4-fluorobenzene |
| PubChem CID | 143106824 |
| Molecular Formula | C12H21FO |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | ethane;1-ethoxy-4-fluorobenzene |
| SMILES | CC.CC.CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C8H9FO.2C2H6/c1-2-10-8-5-3-7(9)4-6-8;2*1-2/h3-6H,2H2,1H3;2*1-2H3 |
| InChIKey | IYYBDYGBKPLYFP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethoxy-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethoxy-4-fluorobenzene?
The IUPAC name of ethane;1-ethoxy-4-fluorobenzene (CID 143106824) is ethane;1-ethoxy-4-fluorobenzene.
What is the SMILES notation for ethane;1-ethoxy-4-fluorobenzene?
The canonical SMILES for ethane;1-ethoxy-4-fluorobenzene is CC.CC.CCOc1ccc(F)cc1.
What is the InChIKey of ethane;1-ethoxy-4-fluorobenzene?
The InChIKey is IYYBDYGBKPLYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO.2C2H6/c1-2-10-8-5-3-7(9)4-6-8;2*1-2/h3-6H,2H2,1H3;2*1-2H3.
What are the key properties of ethane;1-ethoxy-4-fluorobenzene?
ethane;1-ethoxy-4-fluorobenzene has a molecular weight of 200.30 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethoxy-4-fluorobenzene is sourced from PubChem (CID 143106824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).