C19H28O3 — CID 143106894
(5S)-5-[[4-(3-ethylpentan-3-yl)-2-methylphenoxy]methyl]oxolan-2-one (PubChem CID 143106894) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (5S)-5-[[4-(3-ethylpentan-3-yl)-2-methylphenoxy]methyl]oxolan-2-one.
| Compound Name | (5S)-5-[[4-(3-ethylpentan-3-yl)-2-methylphenoxy]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 143106894 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (5S)-5-[[4-(3-ethylpentan-3-yl)-2-methylphenoxy]methyl]oxolan-2-one |
| SMILES | CCC(CC)(CC)c1ccc(OC[C@@H]2CCC(=O)O2)c(C)c1 |
| InChI | InChI=1S/C19H28O3/c1-5-19(6-2,7-3)15-8-10-17(14(4)12-15)21-13-16-9-11-18(20)22-16/h8,10,12,16H,5-7,9,11,13H2,1-4H3/t16-/m0/s1 |
| InChIKey | JMVFOOHGJYREHB-INIZCTEOSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |