C32H52O3 — CID 143107299
hydroperoxyethane;2-methyl-4-[3-(3-methyl-4-propoxyphenyl)pentan-3-yl]-1-(3,4,4-trimethylpentyl)benzene (PubChem CID 143107299) has the molecular formula C32H52O3 and a molecular weight of 484.77 g/mol. Its IUPAC name is hydroperoxyethane;2-methyl-4-[3-(3-methyl-4-propoxyphenyl)pentan-3-yl]-1-(3,4,4-trimethylpentyl)benzene.
| Compound Name | hydroperoxyethane;2-methyl-4-[3-(3-methyl-4-propoxyphenyl)pentan-3-yl]-1-(3,4,4-trimethylpentyl)benzene |
|---|---|
| PubChem CID | 143107299 |
| Molecular Formula | C32H52O3 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | hydroperoxyethane;2-methyl-4-[3-(3-methyl-4-propoxyphenyl)pentan-3-yl]-1-(3,4,4-trimethylpentyl)benzene |
| SMILES | CCCOc1ccc(C(CC)(CC)c2ccc(CCC(C)C(C)(C)C)c(C)c2)cc1C.CCOO |
| InChI | InChI=1S/C30H46O.C2H6O2/c1-10-19-31-28-18-17-27(21-23(28)5)30(11-2,12-3)26-16-15-25(22(4)20-26)14-13-24(6)29(7,8)9;1-2-4-3/h15-18,20-21,24H,10-14,19H2,1-9H3;3H,2H2,1H3 |
| InChIKey | ZNIJJBPIHMZNSE-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|