C22H27BrFNO3S — CID 143107466
1-[[1-(3-bromophenyl)cyclohexyl]amino]-3-(3-fluoro-5-methylphenyl)sulfonylpropan-2-ol (PubChem CID 143107466) has the molecular formula C22H27BrFNO3S and a molecular weight of 484.43 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)cyclohexyl]amino]-3-(3-fluoro-5-methylphenyl)sulfonylpropan-2-ol.
| Compound Name | 1-[[1-(3-bromophenyl)cyclohexyl]amino]-3-(3-fluoro-5-methylphenyl)sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 143107466 |
| Molecular Formula | C22H27BrFNO3S |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 1-[[1-(3-bromophenyl)cyclohexyl]amino]-3-(3-fluoro-5-methylphenyl)sulfonylpropan-2-ol |
| SMILES | Cc1cc(F)cc(S(=O)(=O)CC(O)CNC2(c3cccc(Br)c3)CCCCC2)c1 |
| InChI | InChI=1S/C22H27BrFNO3S/c1-16-10-19(24)13-21(11-16)29(27,28)15-20(26)14-25-22(8-3-2-4-9-22)17-6-5-7-18(23)12-17/h5-7,10-13,20,25-26H,2-4,8-9,14-15H2,1H3 |
| InChIKey | MUAWEPGIKQMOGV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |