About (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol
(2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol (PubChem CID 143107805) has the molecular formula C22H29F2NOS
and a molecular weight of 393.54 g/mol. Its IUPAC name is (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol.
Molecular Properties
| Compound Name | (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol |
| PubChem CID | 143107805 |
| Molecular Formula | C22H29F2NOS |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol |
| SMILES | CCc1ccc(C2(NC[C@@H](O)CCc3cc(F)cc(F)c3)CCCCC2)s1 |
| InChI | InChI=1S/C22H29F2NOS/c1-2-20-8-9-21(27-20)22(10-4-3-5-11-22)25-15-19(26)7-6-16-12-17(23)14-18(24)13-16/h8-9,12-14,19,25-26H,2-7,10-11,15H2,1H3/t19-/m0/s1 |
| InChIKey | FZKMDTNUCMKOPD-IBGZPJMESA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol?
The IUPAC name of (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol (CID 143107805) is (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol.
What is the SMILES notation for (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol?
The canonical SMILES for (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol is CCc1ccc(C2(NC[C@@H](O)CCc3cc(F)cc(F)c3)CCCCC2)s1.
What is the InChIKey of (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol?
The InChIKey is FZKMDTNUCMKOPD-IBGZPJMESA-N. The full InChI is InChI=1S/C22H29F2NOS/c1-2-20-8-9-21(27-20)22(10-4-3-5-11-22)25-15-19(26)7-6-16-12-17(23)14-18(24)13-16/h8-9,12-14,19,25-26H,2-7,10-11,15H2,1H3/t19-/m0/s1.
What are the key properties of (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol?
(2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol has a molecular weight of 393.54 g/mol, XLogP of 5.33, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(3,5-difluorophenyl)-1-[[1-(5-ethylthiophen-2-yl)cyclohexyl]amino]butan-2-ol is sourced from PubChem (CID 143107805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).