C13H22FNO — CID 143107857
(5Z,6Z)-5-(2-fluoroethylidene)-7-methyl-1-(methylamino)nona-6,8-dien-2-ol (PubChem CID 143107857) has the molecular formula C13H22FNO and a molecular weight of 227.32 g/mol. Its IUPAC name is (5Z,6Z)-5-(2-fluoroethylidene)-7-methyl-1-(methylamino)nona-6,8-dien-2-ol.
| Compound Name | (5Z,6Z)-5-(2-fluoroethylidene)-7-methyl-1-(methylamino)nona-6,8-dien-2-ol |
|---|---|
| PubChem CID | 143107857 |
| Molecular Formula | C13H22FNO |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (5Z,6Z)-5-(2-fluoroethylidene)-7-methyl-1-(methylamino)nona-6,8-dien-2-ol |
| SMILES | C=C/C(C)=C\C(=C/CF)CCC(O)CNC |
| InChI | InChI=1S/C13H22FNO/c1-4-11(2)9-12(7-8-14)5-6-13(16)10-15-3/h4,7,9,13,15-16H,1,5-6,8,10H2,2-3H3/b11-9-,12-7- |
| InChIKey | QAAXLLNUGONANQ-NNHHNCHQSA-N |
| XLogP | 2.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|