C25H33ClN2O3 — CID 143107922
benzyl 3-(3-tert-butylphenyl)piperidine-1-carboxylate;2-chloroacetamide (PubChem CID 143107922) has the molecular formula C25H33ClN2O3 and a molecular weight of 445.00 g/mol. Its IUPAC name is benzyl 3-(3-tert-butylphenyl)piperidine-1-carboxylate;2-chloroacetamide.
| Compound Name | benzyl 3-(3-tert-butylphenyl)piperidine-1-carboxylate;2-chloroacetamide |
|---|---|
| PubChem CID | 143107922 |
| Molecular Formula | C25H33ClN2O3 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | benzyl 3-(3-tert-butylphenyl)piperidine-1-carboxylate;2-chloroacetamide |
| SMILES | CC(C)(C)c1cccc(C2CCCN(C(=O)OCc3ccccc3)C2)c1.NC(=O)CCl |
| InChI | InChI=1S/C23H29NO2.C2H4ClNO/c1-23(2,3)21-13-7-11-19(15-21)20-12-8-14-24(16-20)22(25)26-17-18-9-5-4-6-10-18;3-1-2(4)5/h4-7,9-11,13,15,20H,8,12,14,16-17H2,1-3H3;1H2,(H2,4,5) |
| InChIKey | PWVOABJHBPWQLQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|