C14H10F2N2O3 — CID 143108334
4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]oxy-3-nitrobenzonitrile (PubChem CID 143108334) has the molecular formula C14H10F2N2O3 and a molecular weight of 292.24 g/mol. Its IUPAC name is 4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]oxy-3-nitrobenzonitrile.
| Compound Name | 4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]oxy-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 143108334 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]oxy-3-nitrobenzonitrile |
| SMILES | C=C(/C=C(F)\C=C(/C)F)Oc1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10F2N2O3/c1-9(15)5-12(16)6-10(2)21-14-4-3-11(8-17)7-13(14)18(19)20/h3-7H,2H2,1H3/b9-5+,12-6+ |
| InChIKey | IKSSYEUKHFKAJD-BGNLXQKFSA-N |
| XLogP | 4.09 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|