C12H20N2OS — CID 143108400
ethene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole;methanethiol (PubChem CID 143108400) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is ethene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole;methanethiol.
| Compound Name | ethene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole;methanethiol |
|---|---|
| PubChem CID | 143108400 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | ethene;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole;methanethiol |
| SMILES | C/C=C\C(=C/C)c1nnc(C)o1.C=C.CS |
| InChI | InChI=1S/C9H12N2O.C2H4.CH4S/c1-4-6-8(5-2)9-11-10-7(3)12-9;2*1-2/h4-6H,1-3H3;1-2H2;2H,1H3/b6-4-,8-5+;; |
| InChIKey | DGQDZMRNGZFYNK-WGVBJJOMSA-N |
| XLogP | 3.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|