About 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol
2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol (PubChem CID 143108403) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol.
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol |
| PubChem CID | 143108403 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol |
| SMILES | C=C/C=C\N=C(/C)CS |
| InChI | InChI=1S/C7H11NS/c1-3-4-5-8-7(2)6-9/h3-5,9H,1,6H2,2H3/b5-4-,8-7+ |
| InChIKey | IPFKZSYAMRGFKA-KXKKYDSASA-N |
| XLogP | 2.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol (CID 143108403) is 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol.
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol is C=C/C=C\N=C(/C)CS.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol?
The InChIKey is IPFKZSYAMRGFKA-KXKKYDSASA-N. The full InChI is InChI=1S/C7H11NS/c1-3-4-5-8-7(2)6-9/h3-5,9H,1,6H2,2H3/b5-4-,8-7+.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol?
2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol has a molecular weight of 141.24 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]iminopropane-1-thiol is sourced from PubChem (CID 143108403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).