C13H23NO3 — CID 143108795
[(8aS)-6-hydroxy-2,8a-dimethyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-7-yl] acetate (PubChem CID 143108795) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is [(8aS)-6-hydroxy-2,8a-dimethyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-7-yl] acetate.
| Compound Name | [(8aS)-6-hydroxy-2,8a-dimethyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 143108795 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | [(8aS)-6-hydroxy-2,8a-dimethyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-7-yl] acetate |
| SMILES | CC(=O)OC1C[C@]2(C)CN(C)CCC2CC1O |
| InChI | InChI=1S/C13H23NO3/c1-9(15)17-12-7-13(2)8-14(3)5-4-10(13)6-11(12)16/h10-12,16H,4-8H2,1-3H3/t10?,11?,12?,13-/m1/s1 |
| InChIKey | XLUYPLOQFLTGDA-NODFVKRRSA-N |
| XLogP | 1.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |