About (1S)-1-cyclobutyl-2-phenylethanamine;phosphane
(1S)-1-cyclobutyl-2-phenylethanamine;phosphane (PubChem CID 143108875) has the molecular formula C12H20NP
and a molecular weight of 209.27 g/mol. Its IUPAC name is (1S)-1-cyclobutyl-2-phenylethanamine;phosphane.
Molecular Properties
| Compound Name | (1S)-1-cyclobutyl-2-phenylethanamine;phosphane |
| PubChem CID | 143108875 |
| Molecular Formula | C12H20NP |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (1S)-1-cyclobutyl-2-phenylethanamine;phosphane |
| SMILES | N[C@@H](Cc1ccccc1)C1CCC1.P |
| InChI | InChI=1S/C12H17N.H3P/c13-12(11-7-4-8-11)9-10-5-2-1-3-6-10;/h1-3,5-6,11-12H,4,7-9,13H2;1H3/t12-;/m0./s1 |
| InChIKey | NKVYJMJBYYJOME-YDALLXLXSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-cyclobutyl-2-phenylethanamine;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclobutyl-2-phenylethanamine;phosphane?
The IUPAC name of (1S)-1-cyclobutyl-2-phenylethanamine;phosphane (CID 143108875) is (1S)-1-cyclobutyl-2-phenylethanamine;phosphane.
What is the SMILES notation for (1S)-1-cyclobutyl-2-phenylethanamine;phosphane?
The canonical SMILES for (1S)-1-cyclobutyl-2-phenylethanamine;phosphane is N[C@@H](Cc1ccccc1)C1CCC1.P.
What is the InChIKey of (1S)-1-cyclobutyl-2-phenylethanamine;phosphane?
The InChIKey is NKVYJMJBYYJOME-YDALLXLXSA-N. The full InChI is InChI=1S/C12H17N.H3P/c13-12(11-7-4-8-11)9-10-5-2-1-3-6-10;/h1-3,5-6,11-12H,4,7-9,13H2;1H3/t12-;/m0./s1.
What are the key properties of (1S)-1-cyclobutyl-2-phenylethanamine;phosphane?
(1S)-1-cyclobutyl-2-phenylethanamine;phosphane has a molecular weight of 209.27 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclobutyl-2-phenylethanamine;phosphane is sourced from PubChem (CID 143108875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).