About ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one
ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one (PubChem CID 143109190) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one |
| PubChem CID | 143109190 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one |
| SMILES | C=Cc1o[nH]c(=O)c1/C=C\C.CC |
| InChI | InChI=1S/C8H9NO2.C2H6/c1-3-5-6-7(4-2)11-9-8(6)10;1-2/h3-5H,2H2,1H3,(H,9,10);1-2H3/b5-3-; |
| InChIKey | JKGVJBTWTQJJDQ-FBZPGIPVSA-N |
| XLogP | 2.67 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one?
The IUPAC name of ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one (CID 143109190) is ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one.
What is the SMILES notation for ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one?
The canonical SMILES for ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one is C=Cc1o[nH]c(=O)c1/C=C\C.CC.
What is the InChIKey of ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one?
The InChIKey is JKGVJBTWTQJJDQ-FBZPGIPVSA-N. The full InChI is InChI=1S/C8H9NO2.C2H6/c1-3-5-6-7(4-2)11-9-8(6)10;1-2/h3-5H,2H2,1H3,(H,9,10);1-2H3/b5-3-;.
What are the key properties of ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one?
ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one has a molecular weight of 181.23 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethenyl-4-[(Z)-prop-1-enyl]-1,2-oxazol-3-one is sourced from PubChem (CID 143109190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).