C16H31FN2O2 — CID 143109203
[4-[butyl(fluoromethyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate (PubChem CID 143109203) has the molecular formula C16H31FN2O2 and a molecular weight of 302.43 g/mol. Its IUPAC name is [4-[butyl(fluoromethyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate.
| Compound Name | [4-[butyl(fluoromethyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate |
|---|---|
| PubChem CID | 143109203 |
| Molecular Formula | C16H31FN2O2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | [4-[butyl(fluoromethyl)amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate |
| SMILES | CCCCN(CF)C1CC(C)(C)N(OC(C)=O)C(C)(C)C1 |
| InChI | InChI=1S/C16H31FN2O2/c1-7-8-9-18(12-17)14-10-15(3,4)19(21-13(2)20)16(5,6)11-14/h14H,7-12H2,1-6H3 |
| InChIKey | JGZQNQWEQHKSLX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|