About [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine
[3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine (PubChem CID 143109439) has the molecular formula C9H9ClIN
and a molecular weight of 293.53 g/mol. Its IUPAC name is [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine |
| PubChem CID | 143109439 |
| Molecular Formula | C9H9ClIN |
| Molecular Weight | 293.53 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine |
| SMILES | NCc1cccc(Cl)c1C1=IC1 |
| InChI | InChI=1S/C9H9ClIN/c10-7-3-1-2-6(5-12)9(7)8-4-11-8/h1-3H,4-5,12H2 |
| InChIKey | ATRGAFVPLXNGKU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine?
The IUPAC name of [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine (CID 143109439) is [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine.
What is the SMILES notation for [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine?
The canonical SMILES for [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine is NCc1cccc(Cl)c1C1=IC1.
What is the InChIKey of [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine?
The InChIKey is ATRGAFVPLXNGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClIN/c10-7-3-1-2-6(5-12)9(7)8-4-11-8/h1-3H,4-5,12H2.
What are the key properties of [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine?
[3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine has a molecular weight of 293.53 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-2-(1λ3-iodacyclopropen-2-yl)phenyl]methanamine is sourced from PubChem (CID 143109439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).