C22H30FN3O2 — CID 143109714
ethane;phenyl N-[1-[(2E)-3-fluoroocta-2,4,7-trien-4-yl]pyrazol-3-yl]carbamate (PubChem CID 143109714) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is ethane;phenyl N-[1-[(2E)-3-fluoroocta-2,4,7-trien-4-yl]pyrazol-3-yl]carbamate.
| Compound Name | ethane;phenyl N-[1-[(2E)-3-fluoroocta-2,4,7-trien-4-yl]pyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 143109714 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | ethane;phenyl N-[1-[(2E)-3-fluoroocta-2,4,7-trien-4-yl]pyrazol-3-yl]carbamate |
| SMILES | C=CCC=C(/C(F)=C\C)n1ccc(NC(=O)Oc2ccccc2)n1.CC.CC |
| InChI | InChI=1S/C18H18FN3O2.2C2H6/c1-3-5-11-16(15(19)4-2)22-13-12-17(21-22)20-18(23)24-14-9-7-6-8-10-14;2*1-2/h3-4,6-13H,1,5H2,2H3,(H,20,21,23);2*1-2H3/b15-4+,16-11?;; |
| InChIKey | UPQFCVIOCOMYTP-RDEACGRSSA-N |
| XLogP | 6.84 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|