About ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine
ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine (PubChem CID 143109921) has the molecular formula C11H18FN
and a molecular weight of 183.27 g/mol. Its IUPAC name is ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine.
Molecular Properties
| Compound Name | ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine |
| PubChem CID | 143109921 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine |
| SMILES | CC.NCCC1=C(F)CC=CC=C1 |
| InChI | InChI=1S/C9H12FN.C2H6/c10-9-5-3-1-2-4-8(9)6-7-11;1-2/h1-4H,5-7,11H2;1-2H3 |
| InChIKey | VDGAMVGOLMQJQR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine?
The IUPAC name of ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine (CID 143109921) is ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine.
What is the SMILES notation for ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine?
The canonical SMILES for ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine is CC.NCCC1=C(F)CC=CC=C1.
What is the InChIKey of ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine?
The InChIKey is VDGAMVGOLMQJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN.C2H6/c10-9-5-3-1-2-4-8(9)6-7-11;1-2/h1-4H,5-7,11H2;1-2H3.
What are the key properties of ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine?
ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine has a molecular weight of 183.27 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-fluorocyclohepta-1,4,6-trien-1-yl)ethanamine is sourced from PubChem (CID 143109921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).