C19H31NO — CID 143110079
N-[(1E)-buta-1,3-dienyl]ethanimine;ethane;(5E)-2,2,6-trimethyl-5-prop-2-enylidenepyran (PubChem CID 143110079) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]ethanimine;ethane;(5E)-2,2,6-trimethyl-5-prop-2-enylidenepyran.
| Compound Name | N-[(1E)-buta-1,3-dienyl]ethanimine;ethane;(5E)-2,2,6-trimethyl-5-prop-2-enylidenepyran |
|---|---|
| PubChem CID | 143110079 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]ethanimine;ethane;(5E)-2,2,6-trimethyl-5-prop-2-enylidenepyran |
| SMILES | C=C/C=C/N=C/C.C=C/C=C1\C=CC(C)(C)OC1C.CC |
| InChI | InChI=1S/C11H16O.C6H9N.C2H6/c1-5-6-10-7-8-11(3,4)12-9(10)2;1-3-5-6-7-4-2;1-2/h5-9H,1H2,2-4H3;3-6H,1H2,2H3;1-2H3/b10-6+;6-5+,7-4+; |
| InChIKey | XDDWQZZZVAWJMK-LERWPPAXSA-N |
| XLogP | 5.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|