About N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine
N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine (PubChem CID 143110172) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine |
| PubChem CID | 143110172 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine |
| SMILES | C=CN(CCN)/N=C\CC |
| InChI | InChI=1S/C7H15N3/c1-3-6-9-10(4-2)7-5-8/h4,6H,2-3,5,7-8H2,1H3/b9-6- |
| InChIKey | MVQWCKMMQVGYQB-TWGQIWQCSA-N |
| XLogP | 0.79 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine?
The IUPAC name of N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine (CID 143110172) is N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine.
What is the SMILES notation for N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine?
The canonical SMILES for N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine is C=CN(CCN)/N=C\CC.
What is the InChIKey of N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine?
The InChIKey is MVQWCKMMQVGYQB-TWGQIWQCSA-N. The full InChI is InChI=1S/C7H15N3/c1-3-6-9-10(4-2)7-5-8/h4,6H,2-3,5,7-8H2,1H3/b9-6-.
What are the key properties of N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine?
N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine has a molecular weight of 141.22 g/mol, XLogP of 0.79, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-N'-[(Z)-propylideneamino]ethane-1,2-diamine is sourced from PubChem (CID 143110172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).