C19H33N3O2 — CID 143110174
2-cyclohexylethanamine;6,7-diamino-2,2-dimethyl-3,4-dihydrochromen-3-ol (PubChem CID 143110174) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-cyclohexylethanamine;6,7-diamino-2,2-dimethyl-3,4-dihydrochromen-3-ol.
| Compound Name | 2-cyclohexylethanamine;6,7-diamino-2,2-dimethyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 143110174 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2-cyclohexylethanamine;6,7-diamino-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2cc(N)c(N)cc2CC1O.NCCC1CCCCC1 |
| InChI | InChI=1S/C11H16N2O2.C8H17N/c1-11(2)10(14)4-6-3-7(12)8(13)5-9(6)15-11;9-7-6-8-4-2-1-3-5-8/h3,5,10,14H,4,12-13H2,1-2H3;8H,1-7,9H2 |
| InChIKey | DQWPROTVMQIMBJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|