About ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate
ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate (PubChem CID 143110574) has the molecular formula C13H13F3N2O2
and a molecular weight of 286.25 g/mol. Its IUPAC name is ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate.
Molecular Properties
| Compound Name | ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate |
| PubChem CID | 143110574 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate |
| SMILES | CCOC(=O)C(=CN)/C(=N/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O2/c1-2-20-12(19)10(8-17)11(13(14,15)16)18-9-6-4-3-5-7-9/h3-8H,2,17H2,1H3/b10-8?,18-11- |
| InChIKey | QOJFOXKYWQOHJR-ZSAMEHGYSA-N |
| XLogP | 2.73 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate?
The IUPAC name of ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate (CID 143110574) is ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate.
What is the SMILES notation for ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate?
The canonical SMILES for ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate is CCOC(=O)C(=CN)/C(=N/c1ccccc1)C(F)(F)F.
What is the InChIKey of ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate?
The InChIKey is QOJFOXKYWQOHJR-ZSAMEHGYSA-N. The full InChI is InChI=1S/C13H13F3N2O2/c1-2-20-12(19)10(8-17)11(13(14,15)16)18-9-6-4-3-5-7-9/h3-8H,2,17H2,1H3/b10-8?,18-11-.
What are the key properties of ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate?
ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate has a molecular weight of 286.25 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-phenyliminobutanoate is sourced from PubChem (CID 143110574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).