C12H8N8O3S — CID 143111001
4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-5,8-dihydropyrimido[4,5-d]pyrimidin-2-amine (PubChem CID 143111001) has the molecular formula C12H8N8O3S and a molecular weight of 344.32 g/mol. Its IUPAC name is 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-5,8-dihydropyrimido[4,5-d]pyrimidin-2-amine.
| Compound Name | 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-5,8-dihydropyrimido[4,5-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143111001 |
| Molecular Formula | C12H8N8O3S |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 4-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]-5,8-dihydropyrimido[4,5-d]pyrimidin-2-amine |
| SMILES | Nc1nc2c(c(Sc3ccc([N+](=O)[O-])c4nonc34)n1)CN=CN2 |
| InChI | InChI=1S/C12H8N8O3S/c13-12-16-10-5(3-14-4-15-10)11(17-12)24-7-2-1-6(20(21)22)8-9(7)19-23-18-8/h1-2,4H,3H2,(H3,13,14,15,16,17) |
| InChIKey | DZXUBNLPZSXWQH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 158.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|