About 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid
3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid (PubChem CID 143111051) has the molecular formula C17H31N3O5
and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid.
Molecular Properties
| Compound Name | 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid |
| PubChem CID | 143111051 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid |
| SMILES | CCOCC(CC(=O)O)NC(=O)C1CCCN1C(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C17H31N3O5/c1-5-25-10-11(9-13(21)22)19-15(23)12-7-6-8-20(12)16(24)14(18)17(2,3)4/h11-12,14H,5-10,18H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | QRKWJNRSNQJIDO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid?
The IUPAC name of 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid (CID 143111051) is 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid.
What is the SMILES notation for 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid?
The canonical SMILES for 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid is CCOCC(CC(=O)O)NC(=O)C1CCCN1C(=O)C(N)C(C)(C)C.
What is the InChIKey of 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid?
The InChIKey is QRKWJNRSNQJIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N3O5/c1-5-25-10-11(9-13(21)22)19-15(23)12-7-6-8-20(12)16(24)14(18)17(2,3)4/h11-12,14H,5-10,18H2,1-4H3,(H,19,23)(H,21,22).
What are the key properties of 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid?
3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid has a molecular weight of 357.45 g/mol, XLogP of 0.35, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carbonyl]amino]-4-ethoxybutanoic acid is sourced from PubChem (CID 143111051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).