C30H27ClN2O2 — CID 143111242
(4-methylphenyl) 3-[2-chloro-6-(4-cyanophenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-yl]propanoate (PubChem CID 143111242) has the molecular formula C30H27ClN2O2 and a molecular weight of 483.01 g/mol. Its IUPAC name is (4-methylphenyl) 3-[2-chloro-6-(4-cyanophenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-yl]propanoate.
| Compound Name | (4-methylphenyl) 3-[2-chloro-6-(4-cyanophenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-yl]propanoate |
|---|---|
| PubChem CID | 143111242 |
| Molecular Formula | C30H27ClN2O2 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (4-methylphenyl) 3-[2-chloro-6-(4-cyanophenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-yl]propanoate |
| SMILES | Cc1ccc(OC(=O)CCC2CCc3c([nH]c4ccc(Cl)cc34)C(c3ccc(C#N)cc3)C2)cc1 |
| InChI | InChI=1S/C30H27ClN2O2/c1-19-2-11-24(12-3-19)35-29(34)15-7-20-6-13-25-27-17-23(31)10-14-28(27)33-30(25)26(16-20)22-8-4-21(18-32)5-9-22/h2-5,8-12,14,17,20,26,33H,6-7,13,15-16H2,1H3 |
| InChIKey | DQELYYAUWDWCCZ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|