C20H24ClN3 — CID 143111628
4-chloro-2-[6-[4-(dimethylamino)phenyl]-1,2,3,6-tetrahydropyridin-4-yl]-N-methylaniline (PubChem CID 143111628) has the molecular formula C20H24ClN3 and a molecular weight of 341.89 g/mol. Its IUPAC name is 4-chloro-2-[6-[4-(dimethylamino)phenyl]-1,2,3,6-tetrahydropyridin-4-yl]-N-methylaniline.
| Compound Name | 4-chloro-2-[6-[4-(dimethylamino)phenyl]-1,2,3,6-tetrahydropyridin-4-yl]-N-methylaniline |
|---|---|
| PubChem CID | 143111628 |
| Molecular Formula | C20H24ClN3 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 4-chloro-2-[6-[4-(dimethylamino)phenyl]-1,2,3,6-tetrahydropyridin-4-yl]-N-methylaniline |
| SMILES | CNc1ccc(Cl)cc1C1=CC(c2ccc(N(C)C)cc2)NCC1 |
| InChI | InChI=1S/C20H24ClN3/c1-22-19-9-6-16(21)13-18(19)15-10-11-23-20(12-15)14-4-7-17(8-5-14)24(2)3/h4-9,12-13,20,22-23H,10-11H2,1-3H3 |
| InChIKey | BGJIDRLABPYQSZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|