C19H22O5 — CID 143111723
(7R)-2-(furan-3-yl)-6a-methyl-4,10-dioxo-1,2,4a,5,6,7,8,9,10a,10b-decahydrobenzo[f]isochromene-7-carbaldehyde (PubChem CID 143111723) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (7R)-2-(furan-3-yl)-6a-methyl-4,10-dioxo-1,2,4a,5,6,7,8,9,10a,10b-decahydrobenzo[f]isochromene-7-carbaldehyde.
| Compound Name | (7R)-2-(furan-3-yl)-6a-methyl-4,10-dioxo-1,2,4a,5,6,7,8,9,10a,10b-decahydrobenzo[f]isochromene-7-carbaldehyde |
|---|---|
| PubChem CID | 143111723 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (7R)-2-(furan-3-yl)-6a-methyl-4,10-dioxo-1,2,4a,5,6,7,8,9,10a,10b-decahydrobenzo[f]isochromene-7-carbaldehyde |
| SMILES | CC12CCC3C(=O)OC(c4ccoc4)CC3C1C(=O)CC[C@H]2C=O |
| InChI | InChI=1S/C19H22O5/c1-19-6-4-13-14(17(19)15(21)3-2-12(19)9-20)8-16(24-18(13)22)11-5-7-23-10-11/h5,7,9-10,12-14,16-17H,2-4,6,8H2,1H3/t12-,13?,14?,16?,17?,19?/m0/s1 |
| InChIKey | XXPWDJURDFZJNH-RWBCNSPNSA-N |
| XLogP | 3.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|