About (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane
(3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane (PubChem CID 143112959) has the molecular formula C7H17N3O
and a molecular weight of 159.23 g/mol. Its IUPAC name is (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane.
Molecular Properties
| Compound Name | (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane |
| PubChem CID | 143112959 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane |
| SMILES | C/C(N)=N\C(=O)N(C)C.CC |
| InChI | InChI=1S/C5H11N3O.C2H6/c1-4(6)7-5(9)8(2)3;1-2/h1-3H3,(H2,6,7,9);1-2H3 |
| InChIKey | GUXFJWGUIIUGCL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane?
The IUPAC name of (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane (CID 143112959) is (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane.
What is the SMILES notation for (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane?
The canonical SMILES for (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane is C/C(N)=N\C(=O)N(C)C.CC.
What is the InChIKey of (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane?
The InChIKey is GUXFJWGUIIUGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.C2H6/c1-4(6)7-5(9)8(2)3;1-2/h1-3H3,(H2,6,7,9);1-2H3.
What are the key properties of (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane?
(3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane has a molecular weight of 159.23 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1-aminoethylidene)-1,1-dimethylurea;ethane is sourced from PubChem (CID 143112959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).