C42H36N4O2 — CID 143113013
1-N-[4-(4-aminocyclohexa-1,3-dien-1-yl)oxyphenyl]-4-N-[4-(4-aminophenoxy)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine (PubChem CID 143113013) has the molecular formula C42H36N4O2 and a molecular weight of 628.78 g/mol. Its IUPAC name is 1-N-[4-(4-aminocyclohexa-1,3-dien-1-yl)oxyphenyl]-4-N-[4-(4-aminophenoxy)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine.
| Compound Name | 1-N-[4-(4-aminocyclohexa-1,3-dien-1-yl)oxyphenyl]-4-N-[4-(4-aminophenoxy)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143113013 |
| Molecular Formula | C42H36N4O2 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | 1-N-[4-(4-aminocyclohexa-1,3-dien-1-yl)oxyphenyl]-4-N-[4-(4-aminophenoxy)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
| SMILES | NC1=CC=C(Oc2ccc(N(c3ccccc3)c3ccc(N(c4ccccc4)c4ccc(Oc5ccc(N)cc5)cc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C42H36N4O2/c43-31-11-23-39(24-12-31)47-41-27-19-37(20-28-41)45(33-7-3-1-4-8-33)35-15-17-36(18-16-35)46(34-9-5-2-6-10-34)38-21-29-42(30-22-38)48-40-25-13-32(44)14-26-40/h1-13,15-25,27-30H,14,26,43-44H2 |
| InChIKey | UQTCBADYMTUNRJ-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|